About CID 178035195
CID 178035195 (PubChem CID 178035195) has the molecular formula C24H10BF2NO3
and a molecular weight of 409.16 g/mol.
Molecular Properties
| Compound Name | CID 178035195 |
| PubChem CID | 178035195 |
| Molecular Formula | C24H10BF2NO3 |
| Molecular Weight | 409.16 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | — |
| SMILES | [B]c1cc2c(=O)n(-c3ccccc3)c(=O)c3cc(F)c4c5cc(F)ccc5oc1c4c23 |
| InChI | InChI=1S/C24H10BF2NO3/c25-16-9-14-19-15(24(30)28(23(14)29)12-4-2-1-3-5-12)10-17(27)20-13-8-11(26)6-7-18(13)31-22(16)21(19)20/h1-10H |
| InChIKey | VALIMIFBFLWJGC-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 52.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.16 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze CID 178035195 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 178035195?
The IUPAC name of CID 178035195 (CID 178035195) is not available.
What is the SMILES notation for CID 178035195?
The canonical SMILES for CID 178035195 is [B]c1cc2c(=O)n(-c3ccccc3)c(=O)c3cc(F)c4c5cc(F)ccc5oc1c4c23.
What is the InChIKey of CID 178035195?
The InChIKey is VALIMIFBFLWJGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H10BF2NO3/c25-16-9-14-19-15(24(30)28(23(14)29)12-4-2-1-3-5-12)10-17(27)20-13-8-11(26)6-7-18(13)31-22(16)21(19)20/h1-10H.
What are the key properties of CID 178035195?
CID 178035195 has a molecular weight of 409.16 g/mol, XLogP of 3.91, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 178035195 is sourced from PubChem (CID 178035195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).