C18H11NO4 — CID 163192365
3-hydroxy-2-phenylchromeno[2,3-c]pyridine-1,5-dione (PubChem CID 163192365) has the molecular formula C18H11NO4 and a molecular weight of 305.29 g/mol. Its IUPAC name is 3-hydroxy-2-phenylchromeno[2,3-c]pyridine-1,5-dione.
| Compound Name | 3-hydroxy-2-phenylchromeno[2,3-c]pyridine-1,5-dione |
|---|---|
| PubChem CID | 163192365 |
| Molecular Formula | C18H11NO4 |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 3-hydroxy-2-phenylchromeno[2,3-c]pyridine-1,5-dione |
| SMILES | O=c1c2ccccc2oc2c(=O)n(-c3ccccc3)c(O)cc12 |
| InChI | InChI=1S/C18H11NO4/c20-15-10-13-16(21)12-8-4-5-9-14(12)23-17(13)18(22)19(15)11-6-2-1-3-7-11/h1-10,20H |
| InChIKey | MWOCUMSUKUONHU-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 72.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|