About 2,4-diiodoxanthen-9-one
2,4-diiodoxanthen-9-one (PubChem CID 172504971) has the molecular formula C13H6I2O2
and a molecular weight of 448.00 g/mol. Its IUPAC name is 2,4-diiodoxanthen-9-one.
Molecular Properties
| Compound Name | 2,4-diiodoxanthen-9-one |
| PubChem CID | 172504971 |
| Molecular Formula | C13H6I2O2 |
| Molecular Weight | 448.00 g/mol |
| Exact Mass | 447.85 |
| IUPAC Name | 2,4-diiodoxanthen-9-one |
| SMILES | O=c1c2ccccc2oc2c(I)cc(I)cc12 |
| InChI | InChI=1S/C13H6I2O2/c14-7-5-9-12(16)8-3-1-2-4-11(8)17-13(9)10(15)6-7/h1-6H |
| InChIKey | KGRVQRJOFDPRFZ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 448.00 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2,4-diiodoxanthen-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-diiodoxanthen-9-one?
The IUPAC name of 2,4-diiodoxanthen-9-one (CID 172504971) is 2,4-diiodoxanthen-9-one.
What is the SMILES notation for 2,4-diiodoxanthen-9-one?
The canonical SMILES for 2,4-diiodoxanthen-9-one is O=c1c2ccccc2oc2c(I)cc(I)cc12.
What is the InChIKey of 2,4-diiodoxanthen-9-one?
The InChIKey is KGRVQRJOFDPRFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H6I2O2/c14-7-5-9-12(16)8-3-1-2-4-11(8)17-13(9)10(15)6-7/h1-6H.
What are the key properties of 2,4-diiodoxanthen-9-one?
2,4-diiodoxanthen-9-one has a molecular weight of 448.00 g/mol, XLogP of 4.16, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-diiodoxanthen-9-one is sourced from PubChem (CID 172504971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).