C12H6I2O — CID 56649788
2,6-diiododibenzofuran (PubChem CID 56649788) has the molecular formula C12H6I2O and a molecular weight of 419.99 g/mol. Its IUPAC name is 2,6-diiododibenzofuran.
| Compound Name | 2,6-diiododibenzofuran |
|---|---|
| PubChem CID | 56649788 |
| Molecular Formula | C12H6I2O |
| Molecular Weight | 419.99 g/mol |
| Exact Mass | 419.85 |
| IUPAC Name | 2,6-diiododibenzofuran |
| SMILES | Ic1ccc2oc3c(I)cccc3c2c1 |
| InChI | InChI=1S/C12H6I2O/c13-7-4-5-11-9(6-7)8-2-1-3-10(14)12(8)15-11/h1-6H |
| InChIKey | UGYKXINKPOXHAS-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.99 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|