About 8-bromodibenzofuran-4-ol
8-bromodibenzofuran-4-ol (PubChem CID 163774283) has the molecular formula C12H7BrO2
and a molecular weight of 263.09 g/mol. Its IUPAC name is 8-bromodibenzofuran-4-ol.
Molecular Properties
| Compound Name | 8-bromodibenzofuran-4-ol |
| PubChem CID | 163774283 |
| Molecular Formula | C12H7BrO2 |
| Molecular Weight | 263.09 g/mol |
| Exact Mass | 261.96 |
| IUPAC Name | 8-bromodibenzofuran-4-ol |
| SMILES | Oc1cccc2c1oc1ccc(Br)cc12 |
| InChI | InChI=1S/C12H7BrO2/c13-7-4-5-11-9(6-7)8-2-1-3-10(14)12(8)15-11/h1-6,14H |
| InChIKey | MJBRDTCCJKHUBO-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.09 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-bromodibenzofuran-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromodibenzofuran-4-ol?
The IUPAC name of 8-bromodibenzofuran-4-ol (CID 163774283) is 8-bromodibenzofuran-4-ol.
What is the SMILES notation for 8-bromodibenzofuran-4-ol?
The canonical SMILES for 8-bromodibenzofuran-4-ol is Oc1cccc2c1oc1ccc(Br)cc12.
What is the InChIKey of 8-bromodibenzofuran-4-ol?
The InChIKey is MJBRDTCCJKHUBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7BrO2/c13-7-4-5-11-9(6-7)8-2-1-3-10(14)12(8)15-11/h1-6,14H.
What are the key properties of 8-bromodibenzofuran-4-ol?
8-bromodibenzofuran-4-ol has a molecular weight of 263.09 g/mol, XLogP of 4.05, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromodibenzofuran-4-ol is sourced from PubChem (CID 163774283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).