C12H8BBrO3 — CID 142752650
(8-bromodibenzofuran-4-yl)boronic acid (PubChem CID 142752650) has the molecular formula C12H8BBrO3 and a molecular weight of 290.91 g/mol. Its IUPAC name is (8-bromodibenzofuran-4-yl)boronic acid.
| Compound Name | (8-bromodibenzofuran-4-yl)boronic acid |
|---|---|
| PubChem CID | 142752650 |
| Molecular Formula | C12H8BBrO3 |
| Molecular Weight | 290.91 g/mol |
| Exact Mass | 289.97 |
| IUPAC Name | (8-bromodibenzofuran-4-yl)boronic acid |
| SMILES | OB(O)c1cccc2c1oc1ccc(Br)cc12 |
| InChI | InChI=1S/C12H8BBrO3/c14-7-4-5-11-9(6-7)8-2-1-3-10(13(15)16)12(8)17-11/h1-6,15-16H |
| InChIKey | GIJYZZWQBHMICW-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.91 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|