naphtho[1,2-b][1]benzofuran-4-ylboronic acid

C16H11BO3 — CID 142752835

IUPACnaphtho[1,2-b][1]benzofuran-4-ylboronic acid
SMILESOB(O)c1cccc2c1ccc1c3ccccc3oc21
InChIInChI=1S/C16H11BO3/c18-17(19)14-6-3-5-12-10(14)8-9-13-11-4-1-2-7-15(11)20-16(12)13/h1-9,18-19H
InChIKeyAVVRKZSCDOAZKF-UHFFFAOYSA-N
MW262.07 g/mol
LogP2.42
Rot. Bonds1

About naphtho[1,2-b][1]benzofuran-4-ylboronic acid

naphtho[1,2-b][1]benzofuran-4-ylboronic acid (PubChem CID 142752835) has the molecular formula C16H11BO3 and a molecular weight of 262.07 g/mol. Its IUPAC name is naphtho[1,2-b][1]benzofuran-4-ylboronic acid.

Molecular Properties

Compound Namenaphtho[1,2-b][1]benzofuran-4-ylboronic acid
PubChem CID142752835
Molecular FormulaC16H11BO3
Molecular Weight262.07 g/mol
Exact Mass262.08
IUPAC Namenaphtho[1,2-b][1]benzofuran-4-ylboronic acid
SMILESOB(O)c1cccc2c1ccc1c3ccccc3oc21
InChIInChI=1S/C16H11BO3/c18-17(19)14-6-3-5-12-10(14)8-9-13-11-4-1-2-7-15(11)20-16(12)13/h1-9,18-19H
InChIKeyAVVRKZSCDOAZKF-UHFFFAOYSA-N
XLogP2.42
TPSA53.60 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500262.07
LogP ≤ 52.42
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze naphtho[1,2-b][1]benzofuran-4-ylboronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of naphtho[1,2-b][1]benzofuran-4-ylboronic acid?
The IUPAC name of naphtho[1,2-b][1]benzofuran-4-ylboronic acid (CID 142752835) is naphtho[1,2-b][1]benzofuran-4-ylboronic acid.
What is the SMILES notation for naphtho[1,2-b][1]benzofuran-4-ylboronic acid?
The canonical SMILES for naphtho[1,2-b][1]benzofuran-4-ylboronic acid is OB(O)c1cccc2c1ccc1c3ccccc3oc21.
What is the InChIKey of naphtho[1,2-b][1]benzofuran-4-ylboronic acid?
The InChIKey is AVVRKZSCDOAZKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11BO3/c18-17(19)14-6-3-5-12-10(14)8-9-13-11-4-1-2-7-15(11)20-16(12)13/h1-9,18-19H.
What are the key properties of naphtho[1,2-b][1]benzofuran-4-ylboronic acid?
naphtho[1,2-b][1]benzofuran-4-ylboronic acid has a molecular weight of 262.07 g/mol, XLogP of 2.42, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for naphtho[1,2-b][1]benzofuran-4-ylboronic acid is sourced from PubChem (CID 142752835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).