C30H16N2O4 — CID 10073329
7,17-diphenyl-7,17-diazapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(20),2,4,9,11,13,15(19)-heptaene-6,8,16,18-tetrone (PubChem CID 10073329) has the molecular formula C30H16N2O4 and a molecular weight of 468.47 g/mol. Its IUPAC name is 7,17-diphenyl-7,17-diazapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(20),2,4,9,11,13,15(19)-heptaene-6,8,16,18-tetrone.
| Compound Name | 7,17-diphenyl-7,17-diazapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(20),2,4,9,11,13,15(19)-heptaene-6,8,16,18-tetrone |
|---|---|
| PubChem CID | 10073329 |
| Molecular Formula | C30H16N2O4 |
| Molecular Weight | 468.47 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | 7,17-diphenyl-7,17-diazapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(20),2,4,9,11,13,15(19)-heptaene-6,8,16,18-tetrone |
| SMILES | O=c1c2cc3cc4cc5c(=O)n(-c6ccccc6)c(=O)c5cc4cc3cc2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C30H16N2O4/c33-27-23-13-17-11-19-15-25-26(30(36)32(29(25)35)22-9-5-2-6-10-22)16-20(19)12-18(17)14-24(23)28(34)31(27)21-7-3-1-4-8-21/h1-16H |
| InChIKey | AYAZPSSAXWGAGH-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 78.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.47 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|