C19H21NO — CID 165126064
3,4-dimethyl-2-phenylisoquinolin-1-one;ethane (PubChem CID 165126064) has the molecular formula C19H21NO and a molecular weight of 279.38 g/mol. Its IUPAC name is 3,4-dimethyl-2-phenylisoquinolin-1-one;ethane.
| Compound Name | 3,4-dimethyl-2-phenylisoquinolin-1-one;ethane |
|---|---|
| PubChem CID | 165126064 |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 3,4-dimethyl-2-phenylisoquinolin-1-one;ethane |
| SMILES | CC.Cc1c(C)n(-c2ccccc2)c(=O)c2ccccc12 |
| InChI | InChI=1S/C17H15NO.C2H6/c1-12-13(2)18(14-8-4-3-5-9-14)17(19)16-11-7-6-10-15(12)16;1-2/h3-11H,1-2H3;1-2H3 |
| InChIKey | HICUWJSOFKQYJZ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |