C17H14N2O2 — CID 4897006
3-hydroxy-4-(methyliminomethyl)-2-phenylisoquinolin-1-one (PubChem CID 4897006) has the molecular formula C17H14N2O2 and a molecular weight of 278.31 g/mol. Its IUPAC name is 3-hydroxy-4-(methyliminomethyl)-2-phenylisoquinolin-1-one.
| Compound Name | 3-hydroxy-4-(methyliminomethyl)-2-phenylisoquinolin-1-one |
|---|---|
| PubChem CID | 4897006 |
| Molecular Formula | C17H14N2O2 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 3-hydroxy-4-(methyliminomethyl)-2-phenylisoquinolin-1-one |
| SMILES | C/N=C/c1c(O)n(-c2ccccc2)c(=O)c2ccccc12 |
| InChI | InChI=1S/C17H14N2O2/c1-18-11-15-13-9-5-6-10-14(13)16(20)19(17(15)21)12-7-3-2-4-8-12/h2-11,21H,1H3/b18-11+ |
| InChIKey | VLSPODBJCGHICZ-WOJGMQOQSA-N |
| XLogP | 2.74 |
| TPSA | 54.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|