C22H16IN3O3 — CID 135875624
3-hydroxy-6-iodo-4-[(2-oxo-1-phenyl-4-pyridinyl)methyliminomethyl]-2H-isoquinolin-1-one (PubChem CID 135875624) has the molecular formula C22H16IN3O3 and a molecular weight of 497.29 g/mol. Its IUPAC name is 3-hydroxy-6-iodo-4-[(2-oxo-1-phenyl-4-pyridinyl)methyliminomethyl]-2H-isoquinolin-1-one.
| Compound Name | 3-hydroxy-6-iodo-4-[(2-oxo-1-phenyl-4-pyridinyl)methyliminomethyl]-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 135875624 |
| Molecular Formula | C22H16IN3O3 |
| Molecular Weight | 497.29 g/mol |
| Exact Mass | 497.02 |
| IUPAC Name | 3-hydroxy-6-iodo-4-[(2-oxo-1-phenyl-4-pyridinyl)methyliminomethyl]-2H-isoquinolin-1-one |
| SMILES | O=c1[nH]c(O)c(/C=N/Cc2ccn(-c3ccccc3)c(=O)c2)c2cc(I)ccc12 |
| InChI | InChI=1S/C22H16IN3O3/c23-15-6-7-17-18(11-15)19(22(29)25-21(17)28)13-24-12-14-8-9-26(20(27)10-14)16-4-2-1-3-5-16/h1-11,13H,12H2,(H2,25,28,29)/b24-13+ |
| InChIKey | RUDUPLMEWHJYEC-ZMOGYAJESA-N |
| XLogP | 3.61 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.29 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|