C22H22IN3O2 — CID 135939776
3-hydroxy-6-iodo-4-[[4-(piperidin-1-ylmethyl)phenyl]iminomethyl]-2H-isoquinolin-1-one (PubChem CID 135939776) has the molecular formula C22H22IN3O2 and a molecular weight of 487.34 g/mol. Its IUPAC name is 3-hydroxy-6-iodo-4-[[4-(piperidin-1-ylmethyl)phenyl]iminomethyl]-2H-isoquinolin-1-one.
| Compound Name | 3-hydroxy-6-iodo-4-[[4-(piperidin-1-ylmethyl)phenyl]iminomethyl]-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 135939776 |
| Molecular Formula | C22H22IN3O2 |
| Molecular Weight | 487.34 g/mol |
| Exact Mass | 487.08 |
| IUPAC Name | 3-hydroxy-6-iodo-4-[[4-(piperidin-1-ylmethyl)phenyl]iminomethyl]-2H-isoquinolin-1-one |
| SMILES | O=c1[nH]c(O)c(/C=N/c2ccc(CN3CCCCC3)cc2)c2cc(I)ccc12 |
| InChI | InChI=1S/C22H22IN3O2/c23-16-6-9-18-19(12-16)20(22(28)25-21(18)27)13-24-17-7-4-15(5-8-17)14-26-10-2-1-3-11-26/h4-9,12-13H,1-3,10-11,14H2,(H2,25,27,28)/b24-13+ |
| InChIKey | ANQDQWWAMYOUDW-ZMOGYAJESA-N |
| XLogP | 4.57 |
| TPSA | 68.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.34 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|