C29H27N5O2 — CID 135875728
4-[[3-hydroxy-1-oxo-4-[[4-(piperidin-1-ylmethyl)phenyl]iminomethyl]-2H-isoquinolin-6-yl]amino]benzonitrile (PubChem CID 135875728) has the molecular formula C29H27N5O2 and a molecular weight of 477.57 g/mol. Its IUPAC name is 4-[[3-hydroxy-1-oxo-4-[[4-(piperidin-1-ylmethyl)phenyl]iminomethyl]-2H-isoquinolin-6-yl]amino]benzonitrile.
| Compound Name | 4-[[3-hydroxy-1-oxo-4-[[4-(piperidin-1-ylmethyl)phenyl]iminomethyl]-2H-isoquinolin-6-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 135875728 |
| Molecular Formula | C29H27N5O2 |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | 4-[[3-hydroxy-1-oxo-4-[[4-(piperidin-1-ylmethyl)phenyl]iminomethyl]-2H-isoquinolin-6-yl]amino]benzonitrile |
| SMILES | N#Cc1ccc(Nc2ccc3c(=O)[nH]c(O)c(/C=N/c4ccc(CN5CCCCC5)cc4)c3c2)cc1 |
| InChI | InChI=1S/C29H27N5O2/c30-17-20-4-10-23(11-5-20)32-24-12-13-25-26(16-24)27(29(36)33-28(25)35)18-31-22-8-6-21(7-9-22)19-34-14-2-1-3-15-34/h4-13,16,18,32H,1-3,14-15,19H2,(H2,33,35,36)/b31-18+ |
| InChIKey | JPYFDPSTGBICQV-FDAWAROLSA-N |
| XLogP | 5.59 |
| TPSA | 104.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|