C23H17N5O4 — CID 14042826
4,6-dimethyl-12,14-diphenyl-2,4,6,12,14-pentazatricyclo[8.4.0.03,8]tetradeca-1(10),2,8-triene-5,7,11,13-tetrone (PubChem CID 14042826) has the molecular formula C23H17N5O4 and a molecular weight of 427.42 g/mol. Its IUPAC name is 4,6-dimethyl-12,14-diphenyl-2,4,6,12,14-pentazatricyclo[8.4.0.03,8]tetradeca-1(10),2,8-triene-5,7,11,13-tetrone.
| Compound Name | 4,6-dimethyl-12,14-diphenyl-2,4,6,12,14-pentazatricyclo[8.4.0.03,8]tetradeca-1(10),2,8-triene-5,7,11,13-tetrone |
|---|---|
| PubChem CID | 14042826 |
| Molecular Formula | C23H17N5O4 |
| Molecular Weight | 427.42 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | 4,6-dimethyl-12,14-diphenyl-2,4,6,12,14-pentazatricyclo[8.4.0.03,8]tetradeca-1(10),2,8-triene-5,7,11,13-tetrone |
| SMILES | Cn1c(=O)c2cc3c(=O)n(-c4ccccc4)c(=O)n(-c4ccccc4)c3nc2n(C)c1=O |
| InChI | InChI=1S/C23H17N5O4/c1-25-18-16(20(29)26(2)22(25)31)13-17-19(24-18)27(14-9-5-3-6-10-14)23(32)28(21(17)30)15-11-7-4-8-12-15/h3-13H,1-2H3 |
| InChIKey | QXTYBNWLDUMFDN-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 100.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.42 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|