C17H13Cl2N3O4 — CID 134835130
7-(dichloromethyl)-6-(2-hydroxybenzoyl)-1,3-dimethylpyrido[2,3-d]pyrimidine-2,4-dione (PubChem CID 134835130) has the molecular formula C17H13Cl2N3O4 and a molecular weight of 394.21 g/mol. Its IUPAC name is 7-(dichloromethyl)-6-(2-hydroxybenzoyl)-1,3-dimethylpyrido[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 7-(dichloromethyl)-6-(2-hydroxybenzoyl)-1,3-dimethylpyrido[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 134835130 |
| Molecular Formula | C17H13Cl2N3O4 |
| Molecular Weight | 394.21 g/mol |
| Exact Mass | 393.03 |
| IUPAC Name | 7-(dichloromethyl)-6-(2-hydroxybenzoyl)-1,3-dimethylpyrido[2,3-d]pyrimidine-2,4-dione |
| SMILES | Cn1c(=O)c2cc(C(=O)c3ccccc3O)c(C(Cl)Cl)nc2n(C)c1=O |
| InChI | InChI=1S/C17H13Cl2N3O4/c1-21-15-10(16(25)22(2)17(21)26)7-9(12(20-15)14(18)19)13(24)8-5-3-4-6-11(8)23/h3-7,14,23H,1-2H3 |
| InChIKey | MTLFJSRRGUYYCC-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 94.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.21 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|