About sodium;1,3-dimethyl-7H-purine-2,6-dione;2-hydroxybenzoate
sodium;1,3-dimethyl-7H-purine-2,6-dione;2-hydroxybenzoate (PubChem CID 69117889) has the molecular formula C14H13N4NaO5
and a molecular weight of 340.27 g/mol. Its IUPAC name is sodium;1,3-dimethyl-7H-purine-2,6-dione;2-hydroxybenzoate.
Molecular Properties
| Compound Name | sodium;1,3-dimethyl-7H-purine-2,6-dione;2-hydroxybenzoate |
| PubChem CID | 69117889 |
| Molecular Formula | C14H13N4NaO5 |
| Molecular Weight | 340.27 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | sodium;1,3-dimethyl-7H-purine-2,6-dione;2-hydroxybenzoate |
| SMILES | Cn1c(=O)c2[nH]cnc2n(C)c1=O.O=C([O-])c1ccccc1O.[Na+] |
| InChI | InChI=1S/C7H8N4O2.C7H6O3.Na/c1-10-5-4(8-3-9-5)6(12)11(2)7(10)13;8-6-4-2-1-3-5(6)7(9)10;/h3H,1-2H3,(H,8,9);1-4,8H,(H,9,10);/q;;+1/p-1 |
| InChIKey | ZPVGQXCAELUITQ-UHFFFAOYSA-M |
| XLogP | -4.28 |
| TPSA | 133.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.27 |
| LogP ≤ 5 | -4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze sodium;1,3-dimethyl-7H-purine-2,6-dione;2-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;1,3-dimethyl-7H-purine-2,6-dione;2-hydroxybenzoate?
The IUPAC name of sodium;1,3-dimethyl-7H-purine-2,6-dione;2-hydroxybenzoate (CID 69117889) is sodium;1,3-dimethyl-7H-purine-2,6-dione;2-hydroxybenzoate.
What is the SMILES notation for sodium;1,3-dimethyl-7H-purine-2,6-dione;2-hydroxybenzoate?
The canonical SMILES for sodium;1,3-dimethyl-7H-purine-2,6-dione;2-hydroxybenzoate is Cn1c(=O)c2[nH]cnc2n(C)c1=O.O=C([O-])c1ccccc1O.[Na+].
What is the InChIKey of sodium;1,3-dimethyl-7H-purine-2,6-dione;2-hydroxybenzoate?
The InChIKey is ZPVGQXCAELUITQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H8N4O2.C7H6O3.Na/c1-10-5-4(8-3-9-5)6(12)11(2)7(10)13;8-6-4-2-1-3-5(6)7(9)10;/h3H,1-2H3,(H,8,9);1-4,8H,(H,9,10);/q;;+1/p-1.
What are the key properties of sodium;1,3-dimethyl-7H-purine-2,6-dione;2-hydroxybenzoate?
sodium;1,3-dimethyl-7H-purine-2,6-dione;2-hydroxybenzoate has a molecular weight of 340.27 g/mol, XLogP of -4.28, 1 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;1,3-dimethyl-7H-purine-2,6-dione;2-hydroxybenzoate is sourced from PubChem (CID 69117889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).