About acetic acid;1,3-dimethyl-7H-purine-2,6-dione;methanamine
acetic acid;1,3-dimethyl-7H-purine-2,6-dione;methanamine (PubChem CID 174694484) has the molecular formula C10H17N5O4
and a molecular weight of 271.28 g/mol. Its IUPAC name is acetic acid;1,3-dimethyl-7H-purine-2,6-dione;methanamine.
Molecular Properties
| Compound Name | acetic acid;1,3-dimethyl-7H-purine-2,6-dione;methanamine |
| PubChem CID | 174694484 |
| Molecular Formula | C10H17N5O4 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | acetic acid;1,3-dimethyl-7H-purine-2,6-dione;methanamine |
| SMILES | CC(=O)O.CN.Cn1c(=O)c2[nH]cnc2n(C)c1=O |
| InChI | InChI=1S/C7H8N4O2.C2H4O2.CH5N/c1-10-5-4(8-3-9-5)6(12)11(2)7(10)13;1-2(3)4;1-2/h3H,1-2H3,(H,8,9);1H3,(H,3,4);2H2,1H3 |
| InChIKey | MPXFTDVYNORNSZ-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 136.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze acetic acid;1,3-dimethyl-7H-purine-2,6-dione;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;1,3-dimethyl-7H-purine-2,6-dione;methanamine?
The IUPAC name of acetic acid;1,3-dimethyl-7H-purine-2,6-dione;methanamine (CID 174694484) is acetic acid;1,3-dimethyl-7H-purine-2,6-dione;methanamine.
What is the SMILES notation for acetic acid;1,3-dimethyl-7H-purine-2,6-dione;methanamine?
The canonical SMILES for acetic acid;1,3-dimethyl-7H-purine-2,6-dione;methanamine is CC(=O)O.CN.Cn1c(=O)c2[nH]cnc2n(C)c1=O.
What is the InChIKey of acetic acid;1,3-dimethyl-7H-purine-2,6-dione;methanamine?
The InChIKey is MPXFTDVYNORNSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4O2.C2H4O2.CH5N/c1-10-5-4(8-3-9-5)6(12)11(2)7(10)13;1-2(3)4;1-2/h3H,1-2H3,(H,8,9);1H3,(H,3,4);2H2,1H3.
What are the key properties of acetic acid;1,3-dimethyl-7H-purine-2,6-dione;methanamine?
acetic acid;1,3-dimethyl-7H-purine-2,6-dione;methanamine has a molecular weight of 271.28 g/mol, XLogP of -1.37, 0 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;1,3-dimethyl-7H-purine-2,6-dione;methanamine is sourced from PubChem (CID 174694484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).