C9H13N5O2 — CID 57349183
1-(3-aminopropyl)-3-methyl-7H-purine-2,6-dione (PubChem CID 57349183) has the molecular formula C9H13N5O2 and a molecular weight of 223.24 g/mol. Its IUPAC name is 1-(3-aminopropyl)-3-methyl-7H-purine-2,6-dione.
| Compound Name | 1-(3-aminopropyl)-3-methyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 57349183 |
| Molecular Formula | C9H13N5O2 |
| Molecular Weight | 223.24 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 1-(3-aminopropyl)-3-methyl-7H-purine-2,6-dione |
| SMILES | Cn1c(=O)n(CCCN)c(=O)c2[nH]cnc21 |
| InChI | InChI=1S/C9H13N5O2/c1-13-7-6(11-5-12-7)8(15)14(9(13)16)4-2-3-10/h5H,2-4,10H2,1H3,(H,11,12) |
| InChIKey | FRZYETXAQCSLHZ-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 98.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.24 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |