C13H11FN4O2 — CID 141307151
1-[(2-fluorophenyl)methyl]-3-methyl-7H-purine-2,6-dione (PubChem CID 141307151) has the molecular formula C13H11FN4O2 and a molecular weight of 274.25 g/mol. Its IUPAC name is 1-[(2-fluorophenyl)methyl]-3-methyl-7H-purine-2,6-dione.
| Compound Name | 1-[(2-fluorophenyl)methyl]-3-methyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 141307151 |
| Molecular Formula | C13H11FN4O2 |
| Molecular Weight | 274.25 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 1-[(2-fluorophenyl)methyl]-3-methyl-7H-purine-2,6-dione |
| SMILES | Cn1c(=O)n(Cc2ccccc2F)c(=O)c2[nH]cnc21 |
| InChI | InChI=1S/C13H11FN4O2/c1-17-11-10(15-7-16-11)12(19)18(13(17)20)6-8-4-2-3-5-9(8)14/h2-5,7H,6H2,1H3,(H,15,16) |
| InChIKey | BPMJTWBJMAYWSW-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.25 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |