C7H8I2N4O2 — CID 160576225
1,3-dimethyl-7H-purine-2,6-dione;molecular iodine (PubChem CID 160576225) has the molecular formula C7H8I2N4O2 and a molecular weight of 433.98 g/mol. Its IUPAC name is 1,3-dimethyl-7H-purine-2,6-dione;molecular iodine.
| Compound Name | 1,3-dimethyl-7H-purine-2,6-dione;molecular iodine |
|---|---|
| PubChem CID | 160576225 |
| Molecular Formula | C7H8I2N4O2 |
| Molecular Weight | 433.98 g/mol |
| Exact Mass | 433.87 |
| IUPAC Name | 1,3-dimethyl-7H-purine-2,6-dione;molecular iodine |
| SMILES | Cn1c(=O)c2[nH]cnc2n(C)c1=O.II |
| InChI | InChI=1S/C7H8N4O2.I2/c1-10-5-4(8-3-9-5)6(12)11(2)7(10)13;1-2/h3H,1-2H3,(H,8,9); |
| InChIKey | RBELZENOHYPREJ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.98 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|