C7H8N4O2S — CID 607238
1,3-dimethyl-6-sulfinyl-7H-purin-2-one (PubChem CID 607238) has the molecular formula C7H8N4O2S and a molecular weight of 212.23 g/mol. Its IUPAC name is 1,3-dimethyl-6-sulfinyl-7H-purin-2-one.
| Compound Name | 1,3-dimethyl-6-sulfinyl-7H-purin-2-one |
|---|---|
| PubChem CID | 607238 |
| Molecular Formula | C7H8N4O2S |
| Molecular Weight | 212.23 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | 1,3-dimethyl-6-sulfinyl-7H-purin-2-one |
| SMILES | Cn1c(=S=O)c2[nH]cnc2n(C)c1=O |
| InChI | InChI=1S/C7H8N4O2S/c1-10-5-4(8-3-9-5)6(14-13)11(2)7(10)12/h3H,1-2H3,(H,8,9) |
| InChIKey | LHSJEJDALOWZHU-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.23 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|