C10H14N4O4 — CID 141369369
1-(2,3-dihydroxybutyl)-3-methyl-7H-purine-2,6-dione (PubChem CID 141369369) has the molecular formula C10H14N4O4 and a molecular weight of 254.25 g/mol. Its IUPAC name is 1-(2,3-dihydroxybutyl)-3-methyl-7H-purine-2,6-dione.
| Compound Name | 1-(2,3-dihydroxybutyl)-3-methyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 141369369 |
| Molecular Formula | C10H14N4O4 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | 1-(2,3-dihydroxybutyl)-3-methyl-7H-purine-2,6-dione |
| SMILES | CC(O)C(O)Cn1c(=O)c2[nH]cnc2n(C)c1=O |
| InChI | InChI=1S/C10H14N4O4/c1-5(15)6(16)3-14-9(17)7-8(12-4-11-7)13(2)10(14)18/h4-6,15-16H,3H2,1-2H3,(H,11,12) |
| InChIKey | YMQNSCBFSUEYFX-UHFFFAOYSA-N |
| XLogP | -1.84 |
| TPSA | 113.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |