C11H19N5O2 — CID 70150646
methanamine;1-methyl-3-(2-methylpropyl)-7H-purine-2,6-dione (PubChem CID 70150646) has the molecular formula C11H19N5O2 and a molecular weight of 253.31 g/mol. Its IUPAC name is methanamine;1-methyl-3-(2-methylpropyl)-7H-purine-2,6-dione.
| Compound Name | methanamine;1-methyl-3-(2-methylpropyl)-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 70150646 |
| Molecular Formula | C11H19N5O2 |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | methanamine;1-methyl-3-(2-methylpropyl)-7H-purine-2,6-dione |
| SMILES | CC(C)Cn1c(=O)n(C)c(=O)c2[nH]cnc21.CN |
| InChI | InChI=1S/C10H14N4O2.CH5N/c1-6(2)4-14-8-7(11-5-12-8)9(15)13(3)10(14)16;1-2/h5-6H,4H2,1-3H3,(H,11,12);2H2,1H3 |
| InChIKey | NXQQMIQGEJYTSD-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 98.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |