C10H12N4O3 — CID 21195478
1-methyl-3-(2-methylpropanoyl)-7H-purine-2,6-dione (PubChem CID 21195478) has the molecular formula C10H12N4O3 and a molecular weight of 236.23 g/mol. Its IUPAC name is 1-methyl-3-(2-methylpropanoyl)-7H-purine-2,6-dione.
| Compound Name | 1-methyl-3-(2-methylpropanoyl)-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 21195478 |
| Molecular Formula | C10H12N4O3 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | 1-methyl-3-(2-methylpropanoyl)-7H-purine-2,6-dione |
| SMILES | CC(C)C(=O)n1c(=O)n(C)c(=O)c2[nH]cnc21 |
| InChI | InChI=1S/C10H12N4O3/c1-5(2)8(15)14-7-6(11-4-12-7)9(16)13(3)10(14)17/h4-5H,1-3H3,(H,11,12) |
| InChIKey | OPSKDHPDYWSENB-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 89.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |