C12H17N5O5S — CID 54576064
(2R)-2-acetamido-3-sulfanylpropanoic acid;1,3-dimethyl-7H-purine-2,6-dione (PubChem CID 54576064) has the molecular formula C12H17N5O5S and a molecular weight of 343.37 g/mol. Its IUPAC name is (2R)-2-acetamido-3-sulfanylpropanoic acid;1,3-dimethyl-7H-purine-2,6-dione.
| Compound Name | (2R)-2-acetamido-3-sulfanylpropanoic acid;1,3-dimethyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 54576064 |
| Molecular Formula | C12H17N5O5S |
| Molecular Weight | 343.37 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | (2R)-2-acetamido-3-sulfanylpropanoic acid;1,3-dimethyl-7H-purine-2,6-dione |
| SMILES | CC(=O)N[C@@H](CS)C(=O)O.Cn1c(=O)c2[nH]cnc2n(C)c1=O |
| InChI | InChI=1S/C7H8N4O2.C5H9NO3S/c1-10-5-4(8-3-9-5)6(12)11(2)7(10)13;1-3(7)6-4(2-10)5(8)9/h3H,1-2H3,(H,8,9);4,10H,2H2,1H3,(H,6,7)(H,8,9)/t;4-/m.0/s1 |
| InChIKey | YDXORIPVXALPTD-VWMHFEHESA-N |
| XLogP | -1.53 |
| TPSA | 139.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.37 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|