C16H23N5O7S — CID 71548177
(2R)-2-acetamido-3-sulfanylpropanoic acid;7-(1,3-dioxolan-2-ylmethyl)-1,3-dimethylpurine-2,6-dione (PubChem CID 71548177) has the molecular formula C16H23N5O7S and a molecular weight of 429.46 g/mol. Its IUPAC name is (2R)-2-acetamido-3-sulfanylpropanoic acid;7-(1,3-dioxolan-2-ylmethyl)-1,3-dimethylpurine-2,6-dione.
| Compound Name | (2R)-2-acetamido-3-sulfanylpropanoic acid;7-(1,3-dioxolan-2-ylmethyl)-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 71548177 |
| Molecular Formula | C16H23N5O7S |
| Molecular Weight | 429.46 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | (2R)-2-acetamido-3-sulfanylpropanoic acid;7-(1,3-dioxolan-2-ylmethyl)-1,3-dimethylpurine-2,6-dione |
| SMILES | CC(=O)N[C@@H](CS)C(=O)O.Cn1c(=O)c2c(ncn2CC2OCCO2)n(C)c1=O |
| InChI | InChI=1S/C11H14N4O4.C5H9NO3S/c1-13-9-8(10(16)14(2)11(13)17)15(6-12-9)5-7-18-3-4-19-7;1-3(7)6-4(2-10)5(8)9/h6-7H,3-5H2,1-2H3;4,10H,2H2,1H3,(H,6,7)(H,8,9)/t;4-/m.0/s1 |
| InChIKey | BRXWFFMIDSOAEM-VWMHFEHESA-N |
| XLogP | -1.69 |
| TPSA | 146.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.46 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|