C13H18N4O6 — CID 139072099
acetic acid;7-(1,3-dioxolan-2-ylmethyl)-1,3-dimethylpurine-2,6-dione (PubChem CID 139072099) has the molecular formula C13H18N4O6 and a molecular weight of 326.31 g/mol. Its IUPAC name is acetic acid;7-(1,3-dioxolan-2-ylmethyl)-1,3-dimethylpurine-2,6-dione.
| Compound Name | acetic acid;7-(1,3-dioxolan-2-ylmethyl)-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 139072099 |
| Molecular Formula | C13H18N4O6 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | acetic acid;7-(1,3-dioxolan-2-ylmethyl)-1,3-dimethylpurine-2,6-dione |
| SMILES | CC(=O)O.Cn1c(=O)c2c(ncn2CC2OCCO2)n(C)c1=O |
| InChI | InChI=1S/C11H14N4O4.C2H4O2/c1-13-9-8(10(16)14(2)11(13)17)15(6-12-9)5-7-18-3-4-19-7;1-2(3)4/h6-7H,3-5H2,1-2H3;1H3,(H,3,4) |
| InChIKey | NOONWZMRQCPRBA-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 117.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |