C13H20N4O5 — CID 70407407
acetic acid;propan-2-one;1,3,7-trimethylpurine-2,6-dione (PubChem CID 70407407) has the molecular formula C13H20N4O5 and a molecular weight of 312.33 g/mol. Its IUPAC name is acetic acid;propan-2-one;1,3,7-trimethylpurine-2,6-dione.
| Compound Name | acetic acid;propan-2-one;1,3,7-trimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 70407407 |
| Molecular Formula | C13H20N4O5 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | acetic acid;propan-2-one;1,3,7-trimethylpurine-2,6-dione |
| SMILES | CC(=O)O.CC(C)=O.Cn1c(=O)c2c(ncn2C)n(C)c1=O |
| InChI | InChI=1S/C8H10N4O2.C3H6O.C2H4O2/c1-10-4-9-6-5(10)7(13)12(3)8(14)11(6)2;1-3(2)4;1-2(3)4/h4H,1-3H3;1-2H3;1H3,(H,3,4) |
| InChIKey | FTRVNFVKHCBHBN-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 116.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |