C8H10FeN4O2 — CID 158445461
iron;1,3,7-trimethylpurine-2,6-dione (PubChem CID 158445461) has the molecular formula C8H10FeN4O2 and a molecular weight of 250.04 g/mol. Its IUPAC name is iron;1,3,7-trimethylpurine-2,6-dione.
| Compound Name | iron;1,3,7-trimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 158445461 |
| Molecular Formula | C8H10FeN4O2 |
| Molecular Weight | 250.04 g/mol |
| Exact Mass | 250.02 |
| IUPAC Name | iron;1,3,7-trimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(ncn2C)n(C)c1=O.[Fe] |
| InChI | InChI=1S/C8H10N4O2.Fe/c1-10-4-9-6-5(10)7(13)12(3)8(14)11(6)2;/h4H,1-3H3; |
| InChIKey | HDIJYWZKWBWLSK-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.04 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|