C13H14N8O5 — CID 90404483
7,9-dihydro-3H-purine-2,6,8-trione;1,3,7-trimethylpurine-2,6-dione (PubChem CID 90404483) has the molecular formula C13H14N8O5 and a molecular weight of 362.31 g/mol. Its IUPAC name is 7,9-dihydro-3H-purine-2,6,8-trione;1,3,7-trimethylpurine-2,6-dione.
| Compound Name | 7,9-dihydro-3H-purine-2,6,8-trione;1,3,7-trimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 90404483 |
| Molecular Formula | C13H14N8O5 |
| Molecular Weight | 362.31 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 7,9-dihydro-3H-purine-2,6,8-trione;1,3,7-trimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(ncn2C)n(C)c1=O.O=c1[nH]c(=O)c2[nH]c(=O)[nH]c2[nH]1 |
| InChI | InChI=1S/C8H10N4O2.C5H4N4O3/c1-10-4-9-6-5(10)7(13)12(3)8(14)11(6)2;10-3-1-2(7-4(11)6-1)8-5(12)9-3/h4H,1-3H3;(H4,6,7,8,9,10,11,12) |
| InChIKey | SEFZGRHXCUTRIX-UHFFFAOYSA-N |
| XLogP | -2.80 |
| TPSA | 176.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.31 |
| LogP ≤ 5 | -2.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |