C22H22F8N8O8 — CID 139144451
2,2,3,3,4,4,5,5-octafluorohexanedioic acid;bis(1,3,7-trimethylpurine-2,6-dione) (PubChem CID 139144451) has the molecular formula C22H22F8N8O8 and a molecular weight of 678.45 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5-octafluorohexanedioic acid;bis(1,3,7-trimethylpurine-2,6-dione).
| Compound Name | 2,2,3,3,4,4,5,5-octafluorohexanedioic acid;bis(1,3,7-trimethylpurine-2,6-dione) |
|---|---|
| PubChem CID | 139144451 |
| Molecular Formula | C22H22F8N8O8 |
| Molecular Weight | 678.45 g/mol |
| Exact Mass | 678.14 |
| IUPAC Name | 2,2,3,3,4,4,5,5-octafluorohexanedioic acid;bis(1,3,7-trimethylpurine-2,6-dione) |
| SMILES | Cn1c(=O)c2c(ncn2C)n(C)c1=O.Cn1c(=O)c2c(ncn2C)n(C)c1=O.O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(=O)O |
| InChI | InChI=1S/2C8H10N4O2.C6H2F8O4/c2*1-10-4-9-6-5(10)7(13)12(3)8(14)11(6)2;7-3(8,1(15)16)5(11,12)6(13,14)4(9,10)2(17)18/h2*4H,1-3H3;(H,15,16)(H,17,18) |
| InChIKey | HSXLVUYDBYHERV-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 198.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.45 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|