C8H10N4O2 — CID 13001301
7-methyl-1,3-bis(trideuteriomethyl)purine-2,6-dione (PubChem CID 13001301) has the molecular formula C8H10N4O2 and a molecular weight of 200.23 g/mol. Its IUPAC name is 7-methyl-1,3-bis(trideuteriomethyl)purine-2,6-dione.
| Compound Name | 7-methyl-1,3-bis(trideuteriomethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 13001301 |
| Molecular Formula | C8H10N4O2 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | 7-methyl-1,3-bis(trideuteriomethyl)purine-2,6-dione |
| SMILES | [2H]C([2H])([2H])n1c(=O)c2c(ncn2C)n(C([2H])([2H])[2H])c1=O |
| InChI | InChI=1S/C8H10N4O2/c1-10-4-9-6-5(10)7(13)12(3)8(14)11(6)2/h4H,1-3H3/i2D3,3D3 |
| InChIKey | RYYVLZVUVIJVGH-XERRXZQWSA-N |
| XLogP | -1.03 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |