C8H10N4OS — CID 23269076
1,3,7-trimethyl-2-sulfanylidenepurin-6-one (PubChem CID 23269076) has the molecular formula C8H10N4OS and a molecular weight of 210.26 g/mol. Its IUPAC name is 1,3,7-trimethyl-2-sulfanylidenepurin-6-one.
| Compound Name | 1,3,7-trimethyl-2-sulfanylidenepurin-6-one |
|---|---|
| PubChem CID | 23269076 |
| Molecular Formula | C8H10N4OS |
| Molecular Weight | 210.26 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | 1,3,7-trimethyl-2-sulfanylidenepurin-6-one |
| SMILES | Cn1c(=O)c2c(ncn2C)n(C)c1=S |
| InChI | InChI=1S/C8H10N4OS/c1-10-4-9-6-5(10)7(13)12(3)8(14)11(6)2/h4H,1-3H3 |
| InChIKey | XSSVSOLKRHNOGG-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 44.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.26 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|