C12H20N4O4 — CID 174188609
butane-1,3-diol;1,3,7-trimethylpurine-2,6-dione (PubChem CID 174188609) has the molecular formula C12H20N4O4 and a molecular weight of 284.32 g/mol. Its IUPAC name is butane-1,3-diol;1,3,7-trimethylpurine-2,6-dione.
| Compound Name | butane-1,3-diol;1,3,7-trimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 174188609 |
| Molecular Formula | C12H20N4O4 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | butane-1,3-diol;1,3,7-trimethylpurine-2,6-dione |
| SMILES | CC(O)CCO.Cn1c(=O)c2c(ncn2C)n(C)c1=O |
| InChI | InChI=1S/C8H10N4O2.C4H10O2/c1-10-4-9-6-5(10)7(13)12(3)8(14)11(6)2;1-4(6)2-3-5/h4H,1-3H3;4-6H,2-3H2,1H3 |
| InChIKey | DCIFZKNKXVTAQE-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 102.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |