C10H16N4O4 — CID 122445304
ethane-1,2-diol;1,3,7-trimethylpurine-2,6-dione (PubChem CID 122445304) has the molecular formula C10H16N4O4 and a molecular weight of 256.26 g/mol. Its IUPAC name is ethane-1,2-diol;1,3,7-trimethylpurine-2,6-dione.
| Compound Name | ethane-1,2-diol;1,3,7-trimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 122445304 |
| Molecular Formula | C10H16N4O4 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | ethane-1,2-diol;1,3,7-trimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(ncn2C)n(C)c1=O.OCCO |
| InChI | InChI=1S/C8H10N4O2.C2H6O2/c1-10-4-9-6-5(10)7(13)12(3)8(14)11(6)2;3-1-2-4/h4H,1-3H3;3-4H,1-2H2 |
| InChIKey | VQACSWQLTMNCSZ-UHFFFAOYSA-N |
| XLogP | -2.06 |
| TPSA | 102.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |