C8H14N4O3Si — CID 159880606
hydroxysilane;1,3,7-trimethylpurine-2,6-dione (PubChem CID 159880606) has the molecular formula C8H14N4O3Si and a molecular weight of 242.31 g/mol. Its IUPAC name is hydroxysilane;1,3,7-trimethylpurine-2,6-dione.
| Compound Name | hydroxysilane;1,3,7-trimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 159880606 |
| Molecular Formula | C8H14N4O3Si |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | hydroxysilane;1,3,7-trimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(ncn2C)n(C)c1=O.O[SiH3] |
| InChI | InChI=1S/C8H10N4O2.H4OSi/c1-10-4-9-6-5(10)7(13)12(3)8(14)11(6)2;1-2/h4H,1-3H3;1H,2H3 |
| InChIKey | NTMADBCZHNCQCJ-UHFFFAOYSA-N |
| XLogP | -2.77 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | -2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|