C15H15N4NaO4 — CID 23669229
sodium;1,3,7-trimethylpurine-2,6-dione;benzoate (PubChem CID 23669229) has the molecular formula C15H15N4NaO4 and a molecular weight of 338.30 g/mol. Its IUPAC name is sodium;1,3,7-trimethylpurine-2,6-dione;benzoate.
| Compound Name | sodium;1,3,7-trimethylpurine-2,6-dione;benzoate |
|---|---|
| PubChem CID | 23669229 |
| Molecular Formula | C15H15N4NaO4 |
| Molecular Weight | 338.30 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | sodium;1,3,7-trimethylpurine-2,6-dione;benzoate |
| SMILES | Cn1c(=O)c2c(ncn2C)n(C)c1=O.O=C([O-])c1ccccc1.[Na+] |
| InChI | InChI=1S/C8H10N4O2.C7H6O2.Na/c1-10-4-9-6-5(10)7(13)12(3)8(14)11(6)2;8-7(9)6-4-2-1-3-5-6;/h4H,1-3H3;1-5H,(H,8,9);/q;;+1/p-1 |
| InChIKey | JWBPVFVNISJVEM-UHFFFAOYSA-M |
| XLogP | -3.98 |
| TPSA | 101.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.30 |
| LogP ≤ 5 | -3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |