C18H18MgN8O8 — CID 23043434
magnesium bis(2-(1,7-dimethyl-2,6-dioxopurin-3-yl)acetate) (PubChem CID 23043434) has the molecular formula C18H18MgN8O8 and a molecular weight of 498.70 g/mol. Its IUPAC name is magnesium bis(2-(1,7-dimethyl-2,6-dioxopurin-3-yl)acetate).
| Compound Name | magnesium bis(2-(1,7-dimethyl-2,6-dioxopurin-3-yl)acetate) |
|---|---|
| PubChem CID | 23043434 |
| Molecular Formula | C18H18MgN8O8 |
| Molecular Weight | 498.70 g/mol |
| Exact Mass | 498.11 |
| IUPAC Name | magnesium bis(2-(1,7-dimethyl-2,6-dioxopurin-3-yl)acetate) |
| SMILES | Cn1c(=O)c2c(ncn2C)n(CC(=O)[O-])c1=O.Cn1c(=O)c2c(ncn2C)n(CC(=O)[O-])c1=O.[Mg+2] |
| InChI | InChI=1S/2C9H10N4O4.Mg/c2*1-11-4-10-7-6(11)8(16)12(2)9(17)13(7)3-5(14)15;/h2*4H,3H2,1-2H3,(H,14,15);/q;;+2/p-2 |
| InChIKey | GMVDXGDQPDWOHY-UHFFFAOYSA-L |
| XLogP | -6.01 |
| TPSA | 203.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.70 |
| LogP ≤ 5 | -6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |