C9H11N5O3 — CID 47096637
2-(3,7-dimethyl-2,6-dioxopurin-1-yl)acetamide (PubChem CID 47096637) has the molecular formula C9H11N5O3 and a molecular weight of 237.22 g/mol. Its IUPAC name is 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)acetamide.
| Compound Name | 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)acetamide |
|---|---|
| PubChem CID | 47096637 |
| Molecular Formula | C9H11N5O3 |
| Molecular Weight | 237.22 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)acetamide |
| SMILES | Cn1cnc2c1c(=O)n(CC(N)=O)c(=O)n2C |
| InChI | InChI=1S/C9H11N5O3/c1-12-4-11-7-6(12)8(16)14(3-5(10)15)9(17)13(7)2/h4H,3H2,1-2H3,(H2,10,15) |
| InChIKey | BIBZICLJHBCSMM-UHFFFAOYSA-N |
| XLogP | -2.08 |
| TPSA | 104.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.22 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |