C12H15BrN4O4 — CID 168957622
3-bromopropyl 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)acetate (PubChem CID 168957622) has the molecular formula C12H15BrN4O4 and a molecular weight of 359.18 g/mol. Its IUPAC name is 3-bromopropyl 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)acetate.
| Compound Name | 3-bromopropyl 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)acetate |
|---|---|
| PubChem CID | 168957622 |
| Molecular Formula | C12H15BrN4O4 |
| Molecular Weight | 359.18 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | 3-bromopropyl 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)acetate |
| SMILES | Cn1cnc2c1c(=O)n(CC(=O)OCCCBr)c(=O)n2C |
| InChI | InChI=1S/C12H15BrN4O4/c1-15-7-14-10-9(15)11(19)17(12(20)16(10)2)6-8(18)21-5-3-4-13/h7H,3-6H2,1-2H3 |
| InChIKey | LMAUPSYPZGKFBO-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 88.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.18 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|