C22H22N4O4 — CID 7828526
3-(3,7-dimethyl-2,6-dioxopurin-1-yl)propyl 2-naphthalen-2-ylacetate (PubChem CID 7828526) has the molecular formula C22H22N4O4 and a molecular weight of 406.44 g/mol. Its IUPAC name is 3-(3,7-dimethyl-2,6-dioxopurin-1-yl)propyl 2-naphthalen-2-ylacetate.
| Compound Name | 3-(3,7-dimethyl-2,6-dioxopurin-1-yl)propyl 2-naphthalen-2-ylacetate |
|---|---|
| PubChem CID | 7828526 |
| Molecular Formula | C22H22N4O4 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 3-(3,7-dimethyl-2,6-dioxopurin-1-yl)propyl 2-naphthalen-2-ylacetate |
| SMILES | Cn1cnc2c1c(=O)n(CCCOC(=O)Cc1ccc3ccccc3c1)c(=O)n2C |
| InChI | InChI=1S/C22H22N4O4/c1-24-14-23-20-19(24)21(28)26(22(29)25(20)2)10-5-11-30-18(27)13-15-8-9-16-6-3-4-7-17(16)12-15/h3-4,6-9,12,14H,5,10-11,13H2,1-2H3 |
| InChIKey | UXTPCPGDCCPQMD-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 88.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|