C20H24N4O5 — CID 8911675
3-(3,7-dimethyl-2,6-dioxopurin-1-yl)propyl 2-(3,5-dimethylphenoxy)acetate (PubChem CID 8911675) has the molecular formula C20H24N4O5 and a molecular weight of 400.44 g/mol. Its IUPAC name is 3-(3,7-dimethyl-2,6-dioxopurin-1-yl)propyl 2-(3,5-dimethylphenoxy)acetate.
| Compound Name | 3-(3,7-dimethyl-2,6-dioxopurin-1-yl)propyl 2-(3,5-dimethylphenoxy)acetate |
|---|---|
| PubChem CID | 8911675 |
| Molecular Formula | C20H24N4O5 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 3-(3,7-dimethyl-2,6-dioxopurin-1-yl)propyl 2-(3,5-dimethylphenoxy)acetate |
| SMILES | Cc1cc(C)cc(OCC(=O)OCCCn2c(=O)c3c(ncn3C)n(C)c2=O)c1 |
| InChI | InChI=1S/C20H24N4O5/c1-13-8-14(2)10-15(9-13)29-11-16(25)28-7-5-6-24-19(26)17-18(21-12-22(17)3)23(4)20(24)27/h8-10,12H,5-7,11H2,1-4H3 |
| InChIKey | RTSLWKPEIPVGKL-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 97.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|