C17H16ClFN4O4 — CID 8764103
3-(3,7-dimethyl-2,6-dioxopurin-1-yl)propyl 2-chloro-4-fluorobenzoate (PubChem CID 8764103) has the molecular formula C17H16ClFN4O4 and a molecular weight of 394.79 g/mol. Its IUPAC name is 3-(3,7-dimethyl-2,6-dioxopurin-1-yl)propyl 2-chloro-4-fluorobenzoate.
| Compound Name | 3-(3,7-dimethyl-2,6-dioxopurin-1-yl)propyl 2-chloro-4-fluorobenzoate |
|---|---|
| PubChem CID | 8764103 |
| Molecular Formula | C17H16ClFN4O4 |
| Molecular Weight | 394.79 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | 3-(3,7-dimethyl-2,6-dioxopurin-1-yl)propyl 2-chloro-4-fluorobenzoate |
| SMILES | Cn1cnc2c1c(=O)n(CCCOC(=O)c1ccc(F)cc1Cl)c(=O)n2C |
| InChI | InChI=1S/C17H16ClFN4O4/c1-21-9-20-14-13(21)15(24)23(17(26)22(14)2)6-3-7-27-16(25)11-5-4-10(19)8-12(11)18/h4-5,8-9H,3,6-7H2,1-2H3 |
| InChIKey | DFNIFZMVJXHRTQ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 88.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.79 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|