C22H25N5O5 — CID 18776400
3-(3,7-dimethyl-2,6-dioxopurin-1-yl)propyl 1-(furan-2-ylmethyl)-2,5-dimethylpyrrole-3-carboxylate (PubChem CID 18776400) has the molecular formula C22H25N5O5 and a molecular weight of 439.47 g/mol. Its IUPAC name is 3-(3,7-dimethyl-2,6-dioxopurin-1-yl)propyl 1-(furan-2-ylmethyl)-2,5-dimethylpyrrole-3-carboxylate.
| Compound Name | 3-(3,7-dimethyl-2,6-dioxopurin-1-yl)propyl 1-(furan-2-ylmethyl)-2,5-dimethylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 18776400 |
| Molecular Formula | C22H25N5O5 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | 3-(3,7-dimethyl-2,6-dioxopurin-1-yl)propyl 1-(furan-2-ylmethyl)-2,5-dimethylpyrrole-3-carboxylate |
| SMILES | Cc1cc(C(=O)OCCCn2c(=O)c3c(ncn3C)n(C)c2=O)c(C)n1Cc1ccco1 |
| InChI | InChI=1S/C22H25N5O5/c1-14-11-17(15(2)27(14)12-16-7-5-9-31-16)21(29)32-10-6-8-26-20(28)18-19(23-13-24(18)3)25(4)22(26)30/h5,7,9,11,13H,6,8,10,12H2,1-4H3 |
| InChIKey | LDVHZPFPVCBDQM-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 106.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|