C14H20N4O4 — CID 10852312
ethyl 5-(3,7-dimethyl-2,6-dioxopurin-1-yl)pentanoate (PubChem CID 10852312) has the molecular formula C14H20N4O4 and a molecular weight of 308.34 g/mol. Its IUPAC name is ethyl 5-(3,7-dimethyl-2,6-dioxopurin-1-yl)pentanoate.
| Compound Name | ethyl 5-(3,7-dimethyl-2,6-dioxopurin-1-yl)pentanoate |
|---|---|
| PubChem CID | 10852312 |
| Molecular Formula | C14H20N4O4 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | ethyl 5-(3,7-dimethyl-2,6-dioxopurin-1-yl)pentanoate |
| SMILES | CCOC(=O)CCCCn1c(=O)c2c(ncn2C)n(C)c1=O |
| InChI | InChI=1S/C14H20N4O4/c1-4-22-10(19)7-5-6-8-18-13(20)11-12(15-9-16(11)2)17(3)14(18)21/h9H,4-8H2,1-3H3 |
| InChIKey | JYPKBIVPQQYTHP-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 88.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|