C16H24N4O4 — CID 175033315
ethyl 5-(3,7-dimethyl-2,6-dioxopurin-1-yl)heptanoate (PubChem CID 175033315) has the molecular formula C16H24N4O4 and a molecular weight of 336.39 g/mol. Its IUPAC name is ethyl 5-(3,7-dimethyl-2,6-dioxopurin-1-yl)heptanoate.
| Compound Name | ethyl 5-(3,7-dimethyl-2,6-dioxopurin-1-yl)heptanoate |
|---|---|
| PubChem CID | 175033315 |
| Molecular Formula | C16H24N4O4 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | ethyl 5-(3,7-dimethyl-2,6-dioxopurin-1-yl)heptanoate |
| SMILES | CCOC(=O)CCCC(CC)n1c(=O)c2c(ncn2C)n(C)c1=O |
| InChI | InChI=1S/C16H24N4O4/c1-5-11(8-7-9-12(21)24-6-2)20-15(22)13-14(17-10-18(13)3)19(4)16(20)23/h10-11H,5-9H2,1-4H3 |
| InChIKey | BOMYTJCLQMKWMN-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 88.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |