C18H29N5O4 — CID 10068289
6-(3,7-dimethyl-2,6-dioxopurin-1-yl)hexan-2-yl 2-amino-3-methylbutanoate (PubChem CID 10068289) has the molecular formula C18H29N5O4 and a molecular weight of 379.46 g/mol. Its IUPAC name is 6-(3,7-dimethyl-2,6-dioxopurin-1-yl)hexan-2-yl 2-amino-3-methylbutanoate.
| Compound Name | 6-(3,7-dimethyl-2,6-dioxopurin-1-yl)hexan-2-yl 2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 10068289 |
| Molecular Formula | C18H29N5O4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.22 |
| IUPAC Name | 6-(3,7-dimethyl-2,6-dioxopurin-1-yl)hexan-2-yl 2-amino-3-methylbutanoate |
| SMILES | CC(CCCCn1c(=O)c2c(ncn2C)n(C)c1=O)OC(=O)C(N)C(C)C |
| InChI | InChI=1S/C18H29N5O4/c1-11(2)13(19)17(25)27-12(3)8-6-7-9-23-16(24)14-15(20-10-21(14)4)22(5)18(23)26/h10-13H,6-9,19H2,1-5H3 |
| InChIKey | KJSPULYNSNFTGD-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 114.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|