C18H26N4O5 — CID 18975592
methyl 2-[6-(3,7-dimethyl-2,6-dioxopurin-1-yl)hexan-2-yloxymethyl]prop-2-enoate (PubChem CID 18975592) has the molecular formula C18H26N4O5 and a molecular weight of 378.43 g/mol. Its IUPAC name is methyl 2-[6-(3,7-dimethyl-2,6-dioxopurin-1-yl)hexan-2-yloxymethyl]prop-2-enoate.
| Compound Name | methyl 2-[6-(3,7-dimethyl-2,6-dioxopurin-1-yl)hexan-2-yloxymethyl]prop-2-enoate |
|---|---|
| PubChem CID | 18975592 |
| Molecular Formula | C18H26N4O5 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | methyl 2-[6-(3,7-dimethyl-2,6-dioxopurin-1-yl)hexan-2-yloxymethyl]prop-2-enoate |
| SMILES | C=C(COC(C)CCCCn1c(=O)c2c(ncn2C)n(C)c1=O)C(=O)OC |
| InChI | InChI=1S/C18H26N4O5/c1-12(17(24)26-5)10-27-13(2)8-6-7-9-22-16(23)14-15(19-11-20(14)3)21(4)18(22)25/h11,13H,1,6-10H2,2-5H3 |
| InChIKey | NHHYHZFSSYHDEH-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 97.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|