C16H28N4O3Si — CID 525001
3,7-dimethyl-1-(5-trimethylsilyloxyhexyl)purine-2,6-dione (PubChem CID 525001) has the molecular formula C16H28N4O3Si and a molecular weight of 352.51 g/mol. Its IUPAC name is 3,7-dimethyl-1-(5-trimethylsilyloxyhexyl)purine-2,6-dione.
| Compound Name | 3,7-dimethyl-1-(5-trimethylsilyloxyhexyl)purine-2,6-dione |
|---|---|
| PubChem CID | 525001 |
| Molecular Formula | C16H28N4O3Si |
| Molecular Weight | 352.51 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 3,7-dimethyl-1-(5-trimethylsilyloxyhexyl)purine-2,6-dione |
| SMILES | CC(CCCCn1c(=O)c2c(ncn2C)n(C)c1=O)O[Si](C)(C)C |
| InChI | InChI=1S/C16H28N4O3Si/c1-12(23-24(4,5)6)9-7-8-10-20-15(21)13-14(17-11-18(13)2)19(3)16(20)22/h11-12H,7-10H2,1-6H3 |
| InChIKey | GGVBURBTDDKMTI-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 71.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.51 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|