C20H31BrN4O4 — CID 23287941
[1-bromo-11-(3,7-dimethyl-2,6-dioxopurin-1-yl)undecan-2-yl] acetate (PubChem CID 23287941) has the molecular formula C20H31BrN4O4 and a molecular weight of 471.40 g/mol. Its IUPAC name is [1-bromo-11-(3,7-dimethyl-2,6-dioxopurin-1-yl)undecan-2-yl] acetate.
| Compound Name | [1-bromo-11-(3,7-dimethyl-2,6-dioxopurin-1-yl)undecan-2-yl] acetate |
|---|---|
| PubChem CID | 23287941 |
| Molecular Formula | C20H31BrN4O4 |
| Molecular Weight | 471.40 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | [1-bromo-11-(3,7-dimethyl-2,6-dioxopurin-1-yl)undecan-2-yl] acetate |
| SMILES | CC(=O)OC(CBr)CCCCCCCCCn1c(=O)c2c(ncn2C)n(C)c1=O |
| InChI | InChI=1S/C20H31BrN4O4/c1-15(26)29-16(13-21)11-9-7-5-4-6-8-10-12-25-19(27)17-18(22-14-23(17)2)24(3)20(25)28/h14,16H,4-13H2,1-3H3 |
| InChIKey | LWIOQKNUNLJZCC-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 88.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.40 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|